CAS:1724-08-9|2,3-Norbornanedicarboxylic Acid
Molecular Formula:C9H12O4
Molecular Weight:184.19g/mol
Purity:98 percent
Package:5g/10g/25g/50g/bulk package
- Livrezon atravè lemond
- Kalite asirans
- Sèvis Kliyan 24/7
Pwodwi Entwodiksyon
2,3-Norbornanedicarboxylic Acid(CAS:1724-08-9) has a wide range of applications in scientific research. It is used as a starting material in the synthesis of several different compounds, such as pharmaceuticals and polymers. It is also used as a catalyst in organic synthesis and as a reagent in the synthesis of heterocyclic compounds. Additionally, NBDA is used as a model compound in the study of the mechanism of action of various enzymes and in the study of the structure of proteins.
|
|
|
| bicyclo[2.2.1]heptane-2,3-dicarboxylic acid | |
| MFCD00520577 | |
| 407.7ºC at 760mmHg | |
| 214.5ºC | |
| 1.42g/cm3 | |
| 74.60 | |
| 0.82 | |
| 8.65E-08mmHg at 25 degree | |
| 1.569 | |
| InChI=1S/C9H12O4/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h4-7H,1-3H2,(H,10,11)(H,12,13) | |
| IVVOCRBADNIWDM-UHFFFAOYSA-N |
Baj popilè: cas:1724-08-9|2,3-norbornanedicarboxylic acid, price, quotation, discount, in stock, for sale
