CAS:217973-03-0|Sodium 2,2',2''-(1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetate
Molecular Formula:C14H23N4Na3O6
Molecular Weight:412.32 g/mol
Purity:97 percent
Package:100g/250g/500g/1kg/bulk package
- Livrezon atravè lemond
- Kalite asirans
- Sèvis Kliyan 24/7
Pwodwi Entwodiksyon
Sodium 2,2',2''-(1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetate has been used in a variety of scientific research applications, including as a chelating agent and as a catalyst in organic synthesis. Sodium 2,2',2''-(1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetate has been used to study the binding of metal ions to proteins and other biomolecules, and it has been used to study the interactions between metal ions and DNA. It has also been used to study the interactions between metal ions and cell membranes, as well as to study the interactions between metal ions and enzymes.
|
|
|
| trisodium;2-[4,7-bis(carboxylatomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate | |
| MFCD30609529 | |
| 142.14 | |
| -6.11 | |
| Inert atmosphere,2-8 degree | |
| InChI=1S/C14H26N4O6.3Na/c19-12(20)9-16-3-1-15-2-4-17(10-13(21)22)6-8-18(7-5-16)11-14(23)24;;;/h15H,1-11H2,(H,19,20)(H,21,22)(H,23,24);;;/q;3* plus 1/p-3 | |
| OKHVSTSMWHWVMK-UHFFFAOYSA-K |
Baj popilè: cas:217973-03-0|sodium 2,2',2''-(1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetate, price, quotation, discount, in stock, for sale
