CAS:99586-65-9|4-Chloropicolinamide
Molecular Formula:C6H5ClN2O
Molecular Weight:156.57 g/mol
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- Livrezon atravè lemond
- Kalite asirans
- Sèvis Kliyan 24/7
Pwodwi Entwodiksyon
4-Chloropyridine-2-carboxamide (4-Cl-Pyr-2-Cbz) is an important organic compound that has a wide range of applications in research, industry, and medicine. This compound is a versatile building block for the synthesis of various compounds, such as pharmaceuticals and agrochemicals. It is also used as a starting material in the synthesis of other organic compounds, such as amines and amides. 4-Cl-Pyr-2-Cbz is a colorless, crystalline solid with a melting point of 91-93 degree . It is soluble in most organic solvents, such as water, ethanol, and methanol.
|
|
|
| 4-chloropyridine-2-carboxamide | |
| MFCD01085339 | |
| 1.381 g/cm3 | |
| 298.1ºC at 760 mmHg | |
| 148-152ºC | |
| 134.1ºC | |
| 1.588 | |
| InChI=1S/C6H5ClN2O/c7-4-1-2-9-5(3-4)6(8)10/h1-3H,(H2,8,10) | |
| XIHHOUUTBZSYJH-UHFFFAOYSA-N |
Baj popilè: cas:99586-65-9|4-chloropicolinamide, price, quotation, discount, in stock, for sale
![CAS 2326-78-5|[2,2'-bipiridin]-5,5'-diol](/uploads/202135855/small/cas-2326-78-5-2-2-bipyridine-5-5-diol58366291273.png?size=384x0)
