CAS:67492-50-6|3,5-Dichlorophenylboronic Acid
Molecular Formula:C6H5BCl2O2
Molecular Weight:190.82 g/mol
Purity:97 percent
Package:100g/250g/500g/1kg/bulk package
- Livrezon atravè lemond
- Kalite asirans
- Sèvis Kliyan 24/7
Pwodwi Entwodiksyon
3,5-Dichlorophenylboronic acid has a wide range of applications in scientific research. It has been used as a reagent in the synthesis of polymers, heterocycles, and other organic compounds. It has also been used as a catalyst in organic reactions, such as the Suzuki-Miyaura cross-coupling reaction. Additionally, 3,5-Dichlorophenylboronic acid has been used in the synthesis of pharmaceuticals, such as the antifungal drug terbinafine.
|
|
|
| (3,5-dichlorophenyl)boronic acid | |
| MFCD00051935 | |
| white to off-white powder | |
| 1.47 g/cm3 | |
| 351.7ºC at 760 mmHg | |
| 315ºC | |
| 166.5ºC | |
| 1.577 | |
| 40.46 | |
| 0.67 | |
| InChI=1S/C6H5BCl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H | |
| DKYRKAIKWFHQHM-UHFFFAOYSA-N |
Baj popilè: cas:67492-50-6|3,5-dichlorophenylboronic acid, price, quotation, discount, in stock, for sale
